C25H26N4O4S — CID 6193239
ethyl (Z)-2-cyano-3-[3-[3-(diethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 6193239) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[3-[3-(diethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[3-[3-(diethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 6193239 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[3-[3-(diethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\c1cn(-c2ccccc2)nc1-c1cccc(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C25H26N4O4S/c1-4-28(5-2)34(31,32)23-14-10-11-19(16-23)24-21(15-20(17-26)25(30)33-6-3)18-29(27-24)22-12-8-7-9-13-22/h7-16,18H,4-6H2,1-3H3/b20-15- |
| InChIKey | RFMLZOWAAXBKAU-HKWRFOASSA-N |
| XLogP | 4.04 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|