C28H23N3O3 — CID 4699800
ethyl 2-cyano-3-[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 4699800) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is ethyl 2-cyano-3-[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4699800 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | ethyl 2-cyano-3-[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cn(-c2ccccc2)nc1-c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H23N3O3/c1-2-33-28(32)23(18-29)16-24-19-31(25-13-7-4-8-14-25)30-27(24)22-12-9-15-26(17-22)34-20-21-10-5-3-6-11-21/h3-17,19H,2,20H2,1H3 |
| InChIKey | BNVZGGINGHWCRG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|