C32H28N6O2 — CID 3693505
2-cyano-N-(3-imidazol-1-ylpropyl)-3-[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 3693505) has the molecular formula C32H28N6O2 and a molecular weight of 528.62 g/mol. Its IUPAC name is 2-cyano-N-(3-imidazol-1-ylpropyl)-3-[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(3-imidazol-1-ylpropyl)-3-[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3693505 |
| Molecular Formula | C32H28N6O2 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 2-cyano-N-(3-imidazol-1-ylpropyl)-3-[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1cn(-c2ccccc2)nc1-c1cccc(OCc2ccccc2)c1)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C32H28N6O2/c33-21-27(32(39)35-15-8-17-37-18-16-34-24-37)19-28-22-38(29-12-5-2-6-13-29)36-31(28)26-11-7-14-30(20-26)40-23-25-9-3-1-4-10-25/h1-7,9-14,16,18-20,22,24H,8,15,17,23H2,(H,35,39) |
| InChIKey | GEMXUXXEQCLENO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|