C31H33N7O3S — CID 4700802
2-cyano-N-(3-imidazol-1-ylpropyl)-3-[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 4700802) has the molecular formula C31H33N7O3S and a molecular weight of 583.72 g/mol. Its IUPAC name is 2-cyano-N-(3-imidazol-1-ylpropyl)-3-[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(3-imidazol-1-ylpropyl)-3-[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4700802 |
| Molecular Formula | C31H33N7O3S |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 2-cyano-N-(3-imidazol-1-ylpropyl)-3-[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C(C#N)C(=O)NCCCn3ccnc3)c2)CC1 |
| InChI | InChI=1S/C31H33N7O3S/c1-24-11-16-37(17-12-24)42(40,41)29-10-5-7-25(20-29)30-27(22-38(35-30)28-8-3-2-4-9-28)19-26(21-32)31(39)34-13-6-15-36-18-14-33-23-36/h2-5,7-10,14,18-20,22-24H,6,11-13,15-17H2,1H3,(H,34,39) |
| InChIKey | XLYOVEUAHUSZMN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|