C33H26N4O2 — CID 6178660
(E)-N-benzyl-2-cyano-3-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 6178660) has the molecular formula C33H26N4O2 and a molecular weight of 510.60 g/mol. Its IUPAC name is (E)-N-benzyl-2-cyano-3-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-2-cyano-3-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6178660 |
| Molecular Formula | C33H26N4O2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (E)-N-benzyl-2-cyano-3-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H26N4O2/c34-21-28(33(38)35-22-25-10-4-1-5-11-25)20-29-23-37(30-14-8-3-9-15-30)36-32(29)27-16-18-31(19-17-27)39-24-26-12-6-2-7-13-26/h1-20,23H,22,24H2,(H,35,38)/b28-20+ |
| InChIKey | ZGVGONXHBOYIRJ-VFCFBJKWSA-N |
| XLogP | 6.34 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|