C27H21ClN4O — CID 17384833
(Z)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-[(4-methylphenyl)methyl]prop-2-enamide (PubChem CID 17384833) has the molecular formula C27H21ClN4O and a molecular weight of 452.95 g/mol. Its IUPAC name is (Z)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-[(4-methylphenyl)methyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-[(4-methylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 17384833 |
| Molecular Formula | C27H21ClN4O |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (Z)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-[(4-methylphenyl)methyl]prop-2-enamide |
| SMILES | Cc1ccc(CNC(=O)/C(C#N)=C\c2cn(-c3ccccc3)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H21ClN4O/c1-19-7-9-20(10-8-19)17-30-27(33)22(16-29)15-23-18-32(25-5-3-2-4-6-25)31-26(23)21-11-13-24(28)14-12-21/h2-15,18H,17H2,1H3,(H,30,33)/b22-15- |
| InChIKey | APDQNEMEMLLNOM-JCMHNJIXSA-N |
| XLogP | 5.72 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|