C26H25ClN4O — CID 17384819
(Z)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-cycloheptylprop-2-enamide (PubChem CID 17384819) has the molecular formula C26H25ClN4O and a molecular weight of 444.97 g/mol. Its IUPAC name is (Z)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-cycloheptylprop-2-enamide.
| Compound Name | (Z)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-cycloheptylprop-2-enamide |
|---|---|
| PubChem CID | 17384819 |
| Molecular Formula | C26H25ClN4O |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (Z)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-cycloheptylprop-2-enamide |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C26H25ClN4O/c27-22-14-12-19(13-15-22)25-21(18-31(30-25)24-10-6-3-7-11-24)16-20(17-28)26(32)29-23-8-4-1-2-5-9-23/h3,6-7,10-16,18,23H,1-2,4-5,8-9H2,(H,29,32)/b20-16- |
| InChIKey | FYNVGHKXBGNXJL-SILNSSARSA-N |
| XLogP | 5.94 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|