C24H22N4O3S — CID 44615016
(E)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 44615016) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is (E)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 44615016 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (E)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=C(\C#N)C(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-17-7-9-18(10-8-17)23-20(15-28(27-23)22-5-3-2-4-6-22)13-19(14-25)24(29)26-21-11-12-32(30,31)16-21/h2-10,13,15,21H,11-12,16H2,1H3,(H,26,29)/b19-13+ |
| InChIKey | CJTRQLNCPBNPRH-CPNJWEJPSA-N |
| XLogP | 3.06 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|