C27H27ClN4O4S — CID 4700545
3-[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 4700545) has the molecular formula C27H27ClN4O4S and a molecular weight of 539.06 g/mol. Its IUPAC name is 3-[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | 3-[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4700545 |
| Molecular Formula | C27H27ClN4O4S |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 3-[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)C(=O)NC2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C27H27ClN4O4S/c1-2-3-12-36-25-10-9-19(15-24(25)28)26-21(17-32(31-26)23-7-5-4-6-8-23)14-20(16-29)27(33)30-22-11-13-37(34,35)18-22/h4-10,14-15,17,22H,2-3,11-13,18H2,1H3,(H,30,33) |
| InChIKey | UWPBIILGSOHWII-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|