C30H33N5O5S2 — CID 4701091
2-cyano-3-[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 4701091) has the molecular formula C30H33N5O5S2 and a molecular weight of 607.76 g/mol. Its IUPAC name is 2-cyano-3-[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4701091 |
| Molecular Formula | C30H33N5O5S2 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | 2-cyano-3-[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C(C#N)C(=O)NC3CCS(=O)(=O)C3)c2)C1 |
| InChI | InChI=1S/C30H33N5O5S2/c1-21-13-22(2)18-34(17-21)42(39,40)28-10-6-7-23(15-28)29-25(19-35(33-29)27-8-4-3-5-9-27)14-24(16-31)30(36)32-26-11-12-41(37,38)20-26/h3-10,14-15,19,21-22,26H,11-13,17-18,20H2,1-2H3,(H,32,36) |
| InChIKey | JCZCLOGTNJZXAR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|