C32H31N5O4S — CID 18806666
(Z)-2-cyano-3-[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 18806666) has the molecular formula C32H31N5O4S and a molecular weight of 581.70 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18806666 |
| Molecular Formula | C32H31N5O4S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | (Z)-2-cyano-3-[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\c2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CC(C)OC(C)C3)c2)cc1 |
| InChI | InChI=1S/C32H31N5O4S/c1-22-12-14-28(15-13-22)34-32(38)26(18-33)16-27-21-37(29-9-5-4-6-10-29)35-31(27)25-8-7-11-30(17-25)42(39,40)36-19-23(2)41-24(3)20-36/h4-17,21,23-24H,19-20H2,1-3H3,(H,34,38)/b26-16- |
| InChIKey | LTTZTYCNLUGICD-QQXSKIMKSA-N |
| XLogP | 5.19 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|