C31H30N4O5S2 — CID 4701031
3-[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-2-(4-methylphenyl)sulfonylprop-2-enenitrile (PubChem CID 4701031) has the molecular formula C31H30N4O5S2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 3-[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-2-(4-methylphenyl)sulfonylprop-2-enenitrile.
| Compound Name | 3-[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-2-(4-methylphenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 4701031 |
| Molecular Formula | C31H30N4O5S2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | 3-[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]-2-(4-methylphenyl)sulfonylprop-2-enenitrile |
| SMILES | Cc1ccc(S(=O)(=O)C(C#N)=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CC(C)OC(C)C3)c2)cc1 |
| InChI | InChI=1S/C31H30N4O5S2/c1-22-12-14-28(15-13-22)41(36,37)30(18-32)17-26-21-35(27-9-5-4-6-10-27)33-31(26)25-8-7-11-29(16-25)42(38,39)34-19-23(2)40-24(3)20-34/h4-17,21,23-24H,19-20H2,1-3H3 |
| InChIKey | ZTXCLRWWXYDYMF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 122.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|