C30H28N4O4S2 — CID 6306354
(E)-2-(4-methylphenyl)sulfonyl-3-[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enenitrile (PubChem CID 6306354) has the molecular formula C30H28N4O4S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is (E)-2-(4-methylphenyl)sulfonyl-3-[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(4-methylphenyl)sulfonyl-3-[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6306354 |
| Molecular Formula | C30H28N4O4S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | (E)-2-(4-methylphenyl)sulfonyl-3-[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(S(=O)(=O)/C(C#N)=C/c2cn(-c3ccccc3)nc2-c2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H28N4O4S2/c1-23-10-14-27(15-11-23)39(35,36)29(21-31)20-25-22-34(26-8-4-2-5-9-26)32-30(25)24-12-16-28(17-13-24)40(37,38)33-18-6-3-7-19-33/h2,4-5,8-17,20,22H,3,6-7,18-19H2,1H3/b29-20+ |
| InChIKey | XCYMZAQCMVXWQI-ZTKZIYFRSA-N |
| XLogP | 5.36 |
| TPSA | 113.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|