C28H24N4O5S2 — CID 18806473
(Z)-2-(benzenesulfonyl)-3-[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 18806473) has the molecular formula C28H24N4O5S2 and a molecular weight of 560.66 g/mol. Its IUPAC name is (Z)-2-(benzenesulfonyl)-3-[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(benzenesulfonyl)-3-[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18806473 |
| Molecular Formula | C28H24N4O5S2 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | (Z)-2-(benzenesulfonyl)-3-[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1cccc(S(=O)(=O)N2CCOCC2)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H24N4O5S2/c29-20-27(38(33,34)25-11-5-2-6-12-25)19-23-21-32(24-9-3-1-4-10-24)30-28(23)22-8-7-13-26(18-22)39(35,36)31-14-16-37-17-15-31/h1-13,18-19,21H,14-17H2/b27-19- |
| InChIKey | HEJUKXCKDLCHBL-DIBXZPPDSA-N |
| XLogP | 3.90 |
| TPSA | 122.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|