C28H29N5O4S — CID 2013769
(E)-3-[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 2013769) has the molecular formula C28H29N5O4S and a molecular weight of 531.64 g/mol. Its IUPAC name is (E)-3-[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2013769 |
| Molecular Formula | C28H29N5O4S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (E)-3-[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1cccc(S(=O)(=O)N2CCOCC2)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C28H29N5O4S/c29-20-23(28(34)31-12-5-2-6-13-31)18-24-21-33(25-9-3-1-4-10-25)30-27(24)22-8-7-11-26(19-22)38(35,36)32-14-16-37-17-15-32/h1,3-4,7-11,18-19,21H,2,5-6,12-17H2/b23-18+ |
| InChIKey | AESOWPVRWLRJOR-PTGBLXJZSA-N |
| XLogP | 3.48 |
| TPSA | 108.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|