C27H27N5O3S — CID 4700640
2-cyano-3-[1-phenyl-3-(3-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]-N-prop-2-enylprop-2-enamide (PubChem CID 4700640) has the molecular formula C27H27N5O3S and a molecular weight of 501.61 g/mol. Its IUPAC name is 2-cyano-3-[1-phenyl-3-(3-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]-N-prop-2-enylprop-2-enamide.
| Compound Name | 2-cyano-3-[1-phenyl-3-(3-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 4700640 |
| Molecular Formula | C27H27N5O3S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 2-cyano-3-[1-phenyl-3-(3-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCNC(=O)C(C#N)=Cc1cn(-c2ccccc2)nc1-c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C27H27N5O3S/c1-2-14-29-27(33)22(19-28)17-23-20-32(24-11-5-3-6-12-24)30-26(23)21-10-9-13-25(18-21)36(34,35)31-15-7-4-8-16-31/h2-3,5-6,9-13,17-18,20H,1,4,7-8,14-16H2,(H,29,33) |
| InChIKey | DUFKYVWGYHTZKG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|