C30H29N5O4S — CID 4872744
2-cyano-N-(furan-2-ylmethyl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 4872744) has the molecular formula C30H29N5O4S and a molecular weight of 555.66 g/mol. Its IUPAC name is 2-cyano-N-(furan-2-ylmethyl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(furan-2-ylmethyl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4872744 |
| Molecular Formula | C30H29N5O4S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 2-cyano-N-(furan-2-ylmethyl)-3-[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C(C#N)C(=O)NCc3ccco3)c2)C1 |
| InChI | InChI=1S/C30H29N5O4S/c1-22-8-6-14-34(20-22)40(37,38)28-13-5-9-23(17-28)29-25(21-35(33-29)26-10-3-2-4-11-26)16-24(18-31)30(36)32-19-27-12-7-15-39-27/h2-5,7,9-13,15-17,21-22H,6,8,14,19-20H2,1H3,(H,32,36) |
| InChIKey | QHENPLLPMMUGOB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|