C28H29N5O4S — CID 98169051
(Z)-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]-3-[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 98169051) has the molecular formula C28H29N5O4S and a molecular weight of 531.64 g/mol. Its IUPAC name is (Z)-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]-3-[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]-3-[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 98169051 |
| Molecular Formula | C28H29N5O4S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (Z)-2-cyano-N-[[(2R)-oxolan-2-yl]methyl]-3-[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1cccc(S(=O)(=O)N2CCCC2)c1)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C28H29N5O4S/c29-18-22(28(34)30-19-25-11-7-15-37-25)16-23-20-33(24-9-2-1-3-10-24)31-27(23)21-8-6-12-26(17-21)38(35,36)32-13-4-5-14-32/h1-3,6,8-10,12,16-17,20,25H,4-5,7,11,13-15,19H2,(H,30,34)/b22-16-/t25-/m1/s1 |
| InChIKey | HRCRNFLLZYIRMD-GJISQHIDSA-N |
| XLogP | 3.53 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|