C28H30N4O2S — CID 6069863
(E)-3-[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 6069863) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is (E)-3-[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6069863 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (E)-3-[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | CCCCSc1ccc(-c2nn(-c3ccccc3)cc2/C=C(\C#N)C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C28H30N4O2S/c1-2-3-16-35-26-13-11-21(12-14-26)27-23(20-32(31-27)24-8-5-4-6-9-24)17-22(18-29)28(33)30-19-25-10-7-15-34-25/h4-6,8-9,11-14,17,20,25H,2-3,7,10,15-16,19H2,1H3,(H,30,33)/b22-17+ |
| InChIKey | IWEDNUGKLLLFGC-OQKWZONESA-N |
| XLogP | 5.63 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|