C27H28N4O3 — CID 6521659
(E)-2-cyano-3-[3-(4-ethoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 6521659) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-(4-ethoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-(4-ethoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6521659 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (E)-2-cyano-3-[3-(4-ethoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C(\C#N)C(=O)NCC2CCCO2)c(C)c1 |
| InChI | InChI=1S/C27H28N4O3/c1-3-33-23-11-12-25(19(2)14-23)26-21(18-31(30-26)22-8-5-4-6-9-22)15-20(16-28)27(32)29-17-24-10-7-13-34-24/h4-6,8-9,11-12,14-15,18,24H,3,7,10,13,17H2,1-2H3,(H,29,32)/b20-15+ |
| InChIKey | XEZZGUQBYHJFLU-HMMYKYKNSA-N |
| XLogP | 4.45 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|