C25H23FN4O3 — CID 1280434
(Z)-2-cyano-3-[3-(3-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide (PubChem CID 1280434) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-(3-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-(3-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 1280434 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (Z)-2-cyano-3-[3-(3-fluoro-4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]prop-2-enamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C(/C#N)C(=O)NC[C@@H]2CCCO2)cc1F |
| InChI | InChI=1S/C25H23FN4O3/c1-32-23-10-9-17(13-22(23)26)24-19(16-30(29-24)20-6-3-2-4-7-20)12-18(14-27)25(31)28-15-21-8-5-11-33-21/h2-4,6-7,9-10,12-13,16,21H,5,8,11,15H2,1H3,(H,28,31)/b18-12-/t21-/m0/s1 |
| InChIKey | XBWFSYPYAFZTQD-CNEDASOKSA-N |
| XLogP | 3.89 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|