C26H22N4O3 — CID 3479246
3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 3479246) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 3479246 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-2-cyano-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C26H22N4O3/c27-15-19(26(31)28-16-22-10-6-12-32-22)13-20-17-30(21-8-2-1-3-9-21)29-25(20)24-14-18-7-4-5-11-23(18)33-24/h1-5,7-9,11,13-14,17,22H,6,10,12,16H2,(H,28,31) |
| InChIKey | GKAVNFKAQHRTST-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|