C31H27FN4O3 — CID 6192545
(Z)-2-cyano-3-[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 6192545) has the molecular formula C31H27FN4O3 and a molecular weight of 522.58 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6192545 |
| Molecular Formula | C31H27FN4O3 |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (Z)-2-cyano-3-[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1cccc(OCc2ccccc2F)c1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C31H27FN4O3/c32-29-14-5-4-8-23(29)21-39-27-12-6-9-22(17-27)30-25(20-36(35-30)26-10-2-1-3-11-26)16-24(18-33)31(37)34-19-28-13-7-15-38-28/h1-6,8-12,14,16-17,20,28H,7,13,15,19,21H2,(H,34,37)/b24-16- |
| InChIKey | DHTWESALEVUKRB-JLPGSUDCSA-N |
| XLogP | 5.46 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|