C32H35N5O6S — CID 6193356
ethyl 1-[3-[4-[(Z)-2-cyano-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-enyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 6193356) has the molecular formula C32H35N5O6S and a molecular weight of 617.73 g/mol. Its IUPAC name is ethyl 1-[3-[4-[(Z)-2-cyano-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-enyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-[(Z)-2-cyano-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-enyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 6193356 |
| Molecular Formula | C32H35N5O6S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | ethyl 1-[3-[4-[(Z)-2-cyano-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-enyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3/C=C(/C#N)C(=O)NCC3CCCO3)c2)CC1 |
| InChI | InChI=1S/C32H35N5O6S/c1-2-42-32(39)23-13-15-36(16-14-23)44(40,41)29-12-6-8-24(19-29)30-26(22-37(35-30)27-9-4-3-5-10-27)18-25(20-33)31(38)34-21-28-11-7-17-43-28/h3-6,8-10,12,18-19,22-23,28H,2,7,11,13-17,21H2,1H3,(H,34,38)/b25-18- |
| InChIKey | ZJNGYYXMKIVCQY-BWAHOGKJSA-N |
| XLogP | 3.71 |
| TPSA | 143.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|