C33H29N5O4S2 — CID 4700964
ethyl 1-[3-[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 4700964) has the molecular formula C33H29N5O4S2 and a molecular weight of 623.76 g/mol. Its IUPAC name is ethyl 1-[3-[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 4700964 |
| Molecular Formula | C33H29N5O4S2 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | ethyl 1-[3-[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C(C#N)c3nc4ccccc4s3)c2)CC1 |
| InChI | InChI=1S/C33H29N5O4S2/c1-2-42-33(39)23-15-17-37(18-16-23)44(40,41)28-12-8-9-24(20-28)31-26(22-38(36-31)27-10-4-3-5-11-27)19-25(21-34)32-35-29-13-6-7-14-30(29)43-32/h3-14,19-20,22-23H,2,15-18H2,1H3 |
| InChIKey | UCAJFUIETIXJKL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 118.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|