C32H34N4O5S3 — CID 6193385
ethyl 1-[3-[4-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 6193385) has the molecular formula C32H34N4O5S3 and a molecular weight of 650.85 g/mol. Its IUPAC name is ethyl 1-[3-[4-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 6193385 |
| Molecular Formula | C32H34N4O5S3 |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | ethyl 1-[3-[4-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3/C=C3\SC(=S)N(C4CCCC4)C3=O)c2)CC1 |
| InChI | InChI=1S/C32H34N4O5S3/c1-2-41-31(38)22-15-17-34(18-16-22)44(39,40)27-14-8-9-23(19-27)29-24(21-35(33-29)25-10-4-3-5-11-25)20-28-30(37)36(32(42)43-28)26-12-6-7-13-26/h3-5,8-11,14,19-22,26H,2,6-7,12-13,15-18H2,1H3/b28-20- |
| InChIKey | ITPYNMBSWNLSJW-RRAHZORUSA-N |
| XLogP | 5.65 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|