C33H37N5O5S2 — CID 4701168
ethyl 1-[5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate (PubChem CID 4701168) has the molecular formula C33H37N5O5S2 and a molecular weight of 647.82 g/mol. Its IUPAC name is ethyl 1-[5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4701168 |
| Molecular Formula | C33H37N5O5S2 |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | ethyl 1-[5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2=NC(=O)C(=Cc3cn(-c4ccccc4)nc3-c3cccc(S(=O)(=O)N4CCCCCC4)c3)S2)CC1 |
| InChI | InChI=1S/C33H37N5O5S2/c1-2-43-32(40)24-15-19-36(20-16-24)33-34-31(39)29(44-33)22-26-23-38(27-12-6-5-7-13-27)35-30(26)25-11-10-14-28(21-25)45(41,42)37-17-8-3-4-9-18-37/h5-7,10-14,21-24H,2-4,8-9,15-20H2,1H3 |
| InChIKey | BTOQDKABKRCIFH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 114.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|