C31H33N5O6S2 — CID 4700606
ethyl 1-[5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate (PubChem CID 4700606) has the molecular formula C31H33N5O6S2 and a molecular weight of 635.77 g/mol. Its IUPAC name is ethyl 1-[5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4700606 |
| Molecular Formula | C31H33N5O6S2 |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | ethyl 1-[5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2=NC(=O)C(=Cc3cn(-c4ccccc4)nc3-c3cccc(S(=O)(=O)N4CCOCC4)c3)S2)CC1 |
| InChI | InChI=1S/C31H33N5O6S2/c1-2-42-30(38)22-11-13-34(14-12-22)31-32-29(37)27(43-31)20-24-21-36(25-8-4-3-5-9-25)33-28(24)23-7-6-10-26(19-23)44(39,40)35-15-17-41-18-16-35/h3-10,19-22H,2,11-18H2,1H3 |
| InChIKey | LQULWGFNSOPYGO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 123.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|