C33H37N5O6S2 — CID 6193373
ethyl 1-[3-[4-[(Z)-[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 6193373) has the molecular formula C33H37N5O6S2 and a molecular weight of 663.82 g/mol. Its IUPAC name is ethyl 1-[3-[4-[(Z)-[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-[(Z)-[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 6193373 |
| Molecular Formula | C33H37N5O6S2 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | ethyl 1-[3-[4-[(Z)-[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3/C=C3\SC(N4CC(C)OC(C)C4)=NC3=O)c2)CC1 |
| InChI | InChI=1S/C33H37N5O6S2/c1-4-43-32(40)24-13-15-37(16-14-24)46(41,42)28-12-8-9-25(17-28)30-26(21-38(35-30)27-10-6-5-7-11-27)18-29-31(39)34-33(45-29)36-19-22(2)44-23(3)20-36/h5-12,17-18,21-24H,4,13-16,19-20H2,1-3H3/b29-18- |
| InChIKey | ODHUZXJVCUOTCV-MIXAMLLLSA-N |
| XLogP | 4.58 |
| TPSA | 123.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|