C30H30N4O5S3 — CID 4700933
ethyl 1-[3-[4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 4700933) has the molecular formula C30H30N4O5S3 and a molecular weight of 622.79 g/mol. Its IUPAC name is ethyl 1-[3-[4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 4700933 |
| Molecular Formula | C30H30N4O5S3 |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | ethyl 1-[3-[4-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | C=CCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CCC(C(=O)OCC)CC3)c2)SC1=S |
| InChI | InChI=1S/C30H30N4O5S3/c1-3-15-33-28(35)26(41-30(33)40)19-23-20-34(24-10-6-5-7-11-24)31-27(23)22-9-8-12-25(18-22)42(37,38)32-16-13-21(14-17-32)29(36)39-4-2/h3,5-12,18-21H,1,4,13-17H2,2H3 |
| InChIKey | IIOWZCHVRQSLBZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|