C31H32N4O7S4 — CID 4700943
ethyl 1-[3-[4-[[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 4700943) has the molecular formula C31H32N4O7S4 and a molecular weight of 700.89 g/mol. Its IUPAC name is ethyl 1-[3-[4-[[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[4-[[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 4700943 |
| Molecular Formula | C31H32N4O7S4 |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | ethyl 1-[3-[4-[[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-phenylpyrazol-3-yl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3C=C3SC(=S)N(C4CCS(=O)(=O)C4)C3=O)c2)CC1 |
| InChI | InChI=1S/C31H32N4O7S4/c1-2-42-30(37)21-11-14-33(15-12-21)46(40,41)26-10-6-7-22(17-26)28-23(19-34(32-28)24-8-4-3-5-9-24)18-27-29(36)35(31(43)44-27)25-13-16-45(38,39)20-25/h3-10,17-19,21,25H,2,11-16,20H2,1H3 |
| InChIKey | ZMCILXQJSPAHIZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 135.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|