C22H18N4O3S3 — CID 5261521
3-(1,1-dioxothiolan-3-yl)-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5261521) has the molecular formula C22H18N4O3S3 and a molecular weight of 482.61 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5261521 |
| Molecular Formula | C22H18N4O3S3 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cn(-c3ccccc3)nc2-c2ccncc2)SC(=S)N1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H18N4O3S3/c27-21-19(31-22(30)26(21)18-8-11-32(28,29)14-18)12-16-13-25(17-4-2-1-3-5-17)24-20(16)15-6-9-23-10-7-15/h1-7,9-10,12-13,18H,8,11,14H2 |
| InChIKey | OLUSXCNISHXOPA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|