C26H23N3O4S3 — CID 6883439
(5E)-3-[(3S)-1,1-dioxothiolan-3-yl]-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6883439) has the molecular formula C26H23N3O4S3 and a molecular weight of 537.69 g/mol. Its IUPAC name is (5E)-3-[(3S)-1,1-dioxothiolan-3-yl]-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(3S)-1,1-dioxothiolan-3-yl]-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6883439 |
| Molecular Formula | C26H23N3O4S3 |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | (5E)-3-[(3S)-1,1-dioxothiolan-3-yl]-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/SC(=S)N([C@H]3CCS(=O)(=O)C3)C2=O)cc1 |
| InChI | InChI=1S/C26H23N3O4S3/c1-2-13-33-22-10-8-18(9-11-22)24-19(16-28(27-24)20-6-4-3-5-7-20)15-23-25(30)29(26(34)35-23)21-12-14-36(31,32)17-21/h2-11,15-16,21H,1,12-14,17H2/b23-15+/t21-/m0/s1 |
| InChIKey | RAWCORIRVDMYLK-VQYZLWMVSA-N |
| XLogP | 4.49 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|