C30H24FN3O4S3 — CID 98143711
(5Z)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[[3-[4-[(4-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 98143711) has the molecular formula C30H24FN3O4S3 and a molecular weight of 605.74 g/mol. Its IUPAC name is (5Z)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[[3-[4-[(4-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[[3-[4-[(4-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 98143711 |
| Molecular Formula | C30H24FN3O4S3 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.09 |
| IUPAC Name | (5Z)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[[3-[4-[(4-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cn(-c3ccccc3)nc2-c2ccc(OCc3ccc(F)cc3)cc2)SC(=S)N1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C30H24FN3O4S3/c31-23-10-6-20(7-11-23)18-38-26-12-8-21(9-13-26)28-22(17-33(32-28)24-4-2-1-3-5-24)16-27-29(35)34(30(39)40-27)25-14-15-41(36,37)19-25/h1-13,16-17,25H,14-15,18-19H2/b27-16-/t25-/m1/s1 |
| InChIKey | LHEINPQMRVDVTE-OSYJHYBZSA-N |
| XLogP | 5.65 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|