C28H29N3O4S3 — CID 4187611
3-(1,1-dioxothiolan-3-yl)-5-[[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4187611) has the molecular formula C28H29N3O4S3 and a molecular weight of 567.76 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-[[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-[[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4187611 |
| Molecular Formula | C28H29N3O4S3 |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-[[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)CCOc1ccc(-c2nn(-c3ccccc3)cc2C=C2SC(=S)N(C3CCS(=O)(=O)C3)C2=O)cc1 |
| InChI | InChI=1S/C28H29N3O4S3/c1-19(2)12-14-35-24-10-8-20(9-11-24)26-21(17-30(29-26)22-6-4-3-5-7-22)16-25-27(32)31(28(36)37-25)23-13-15-38(33,34)18-23/h3-11,16-17,19,23H,12-15,18H2,1-2H3 |
| InChIKey | PTIAICMCXVOOKI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|