C26H25N3O3S4 — CID 6238494
(5Z)-3-(1,1-dioxothiolan-3-yl)-5-[[1-phenyl-3-(4-propylsulfanylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6238494) has the molecular formula C26H25N3O3S4 and a molecular weight of 555.77 g/mol. Its IUPAC name is (5Z)-3-(1,1-dioxothiolan-3-yl)-5-[[1-phenyl-3-(4-propylsulfanylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,1-dioxothiolan-3-yl)-5-[[1-phenyl-3-(4-propylsulfanylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6238494 |
| Molecular Formula | C26H25N3O3S4 |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | (5Z)-3-(1,1-dioxothiolan-3-yl)-5-[[1-phenyl-3-(4-propylsulfanylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCSc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\SC(=S)N(C3CCS(=O)(=O)C3)C2=O)cc1 |
| InChI | InChI=1S/C26H25N3O3S4/c1-2-13-34-22-10-8-18(9-11-22)24-19(16-28(27-24)20-6-4-3-5-7-20)15-23-25(30)29(26(33)35-23)21-12-14-36(31,32)17-21/h3-11,15-16,21H,2,12-14,17H2,1H3/b23-15- |
| InChIKey | KZEUBZFJFILYJO-HAHDFKILSA-N |
| XLogP | 5.43 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|