C26H23N3O4S3 — CID 98149620
(5Z)-3-[(3S)-1,1-dioxothiolan-3-yl]-5-[[3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 98149620) has the molecular formula C26H23N3O4S3 and a molecular weight of 537.69 g/mol. Its IUPAC name is (5Z)-3-[(3S)-1,1-dioxothiolan-3-yl]-5-[[3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(3S)-1,1-dioxothiolan-3-yl]-5-[[3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 98149620 |
| Molecular Formula | C26H23N3O4S3 |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | (5Z)-3-[(3S)-1,1-dioxothiolan-3-yl]-5-[[3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C[C@H]1Cc2cc(-c3nn(-c4ccccc4)cc3/C=C3\SC(=S)N([C@H]4CCS(=O)(=O)C4)C3=O)ccc2O1 |
| InChI | InChI=1S/C26H23N3O4S3/c1-16-11-18-12-17(7-8-22(18)33-16)24-19(14-28(27-24)20-5-3-2-4-6-20)13-23-25(30)29(26(34)35-23)21-9-10-36(31,32)15-21/h2-8,12-14,16,21H,9-11,15H2,1H3/b23-13-/t16-,21-/m0/s1 |
| InChIKey | IKDALLQSFLPWAU-QKVAYCKHSA-N |
| XLogP | 4.25 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|