C30H34N4O3S3 — CID 6193320
3-[4-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-dipropylbenzenesulfonamide (PubChem CID 6193320) has the molecular formula C30H34N4O3S3 and a molecular weight of 594.83 g/mol. Its IUPAC name is 3-[4-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-dipropylbenzenesulfonamide.
| Compound Name | 3-[4-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 6193320 |
| Molecular Formula | C30H34N4O3S3 |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 3-[4-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cccc(-c2nn(-c3ccccc3)cc2/C=C2\SC(=S)N(C3CCCC3)C2=O)c1 |
| InChI | InChI=1S/C30H34N4O3S3/c1-3-17-32(18-4-2)40(36,37)26-16-10-11-22(19-26)28-23(21-33(31-28)24-12-6-5-7-13-24)20-27-29(35)34(30(38)39-27)25-14-8-9-15-25/h5-7,10-13,16,19-21,25H,3-4,8-9,14-15,17-18H2,1-2H3/b27-20- |
| InChIKey | KYZFQHYYLUVQEX-OOAXWGSJSA-N |
| XLogP | 6.49 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|