C30H36N4O3S3 — CID 4700864
3-[4-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-dipropylbenzenesulfonamide (PubChem CID 4700864) has the molecular formula C30H36N4O3S3 and a molecular weight of 596.84 g/mol. Its IUPAC name is 3-[4-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-dipropylbenzenesulfonamide.
| Compound Name | 3-[4-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 4700864 |
| Molecular Formula | C30H36N4O3S3 |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 3-[4-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N(CCC)CCC)c2)SC1=S |
| InChI | InChI=1S/C30H36N4O3S3/c1-4-7-11-19-33-29(35)27(39-30(33)38)21-24-22-34(25-14-9-8-10-15-25)31-28(24)23-13-12-16-26(20-23)40(36,37)32(17-5-2)18-6-3/h8-10,12-16,20-22H,4-7,11,17-19H2,1-3H3 |
| InChIKey | NGXGFDFBHVTHNE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|