C34H42N4O3S3 — CID 4701058
5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-octyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4701058) has the molecular formula C34H42N4O3S3 and a molecular weight of 650.94 g/mol. Its IUPAC name is 5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-octyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-octyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4701058 |
| Molecular Formula | C34H42N4O3S3 |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | 5-[[3-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-octyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CC(C)CC(C)C3)c2)SC1=S |
| InChI | InChI=1S/C34H42N4O3S3/c1-4-5-6-7-8-12-18-37-33(39)31(43-34(37)42)21-28-24-38(29-15-10-9-11-16-29)35-32(28)27-14-13-17-30(20-27)44(40,41)36-22-25(2)19-26(3)23-36/h9-11,13-17,20-21,24-26H,4-8,12,18-19,22-23H2,1-3H3 |
| InChIKey | LRFGBCFROAXQOM-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|