C27H28N4O4S3 — CID 18806655
(5Z)-5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18806655) has the molecular formula C27H28N4O4S3 and a molecular weight of 568.75 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18806655 |
| Molecular Formula | C27H28N4O4S3 |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | (5Z)-5-[[3-[3-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CC(C)OC(C)C3)c2)SC1=S |
| InChI | InChI=1S/C27H28N4O4S3/c1-4-30-26(32)24(37-27(30)36)14-21-17-31(22-10-6-5-7-11-22)28-25(21)20-9-8-12-23(13-20)38(33,34)29-15-18(2)35-19(3)16-29/h5-14,17-19H,4,15-16H2,1-3H3/b24-14- |
| InChIKey | XRWVTGIJXOLOLE-OYKKKHCWSA-N |
| XLogP | 4.56 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|