C29H32N4O4S3 — CID 4700760
3-(3-methoxypropyl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4700760) has the molecular formula C29H32N4O4S3 and a molecular weight of 596.80 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-methoxypropyl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4700760 |
| Molecular Formula | C29H32N4O4S3 |
| Molecular Weight | 596.80 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 3-(3-methoxypropyl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CCC(C)CC3)c2)SC1=S |
| InChI | InChI=1S/C29H32N4O4S3/c1-21-12-15-31(16-13-21)40(35,36)25-11-6-8-22(18-25)27-23(20-33(30-27)24-9-4-3-5-10-24)19-26-28(34)32(29(38)39-26)14-7-17-37-2/h3-6,8-11,18-21H,7,12-17H2,1-2H3 |
| InChIKey | XSARJJVHHPUVIP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.80 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|