C27H28N4O5S3 — CID 4700574
3-(3-methoxypropyl)-5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4700574) has the molecular formula C27H28N4O5S3 and a molecular weight of 584.75 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-methoxypropyl)-5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4700574 |
| Molecular Formula | C27H28N4O5S3 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 3-(3-methoxypropyl)-5-[[3-(3-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CCOCC3)c2)SC1=S |
| InChI | InChI=1S/C27H28N4O5S3/c1-35-14-6-11-30-26(32)24(38-27(30)37)18-21-19-31(22-8-3-2-4-9-22)28-25(21)20-7-5-10-23(17-20)39(33,34)29-12-15-36-16-13-29/h2-5,7-10,17-19H,6,11-16H2,1H3 |
| InChIKey | SQJCKKUDCNZSKL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|