C31H34N4O5S3 — CID 6193181
6-[(5Z)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 6193181) has the molecular formula C31H34N4O5S3 and a molecular weight of 638.84 g/mol. Its IUPAC name is 6-[(5Z)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 6193181 |
| Molecular Formula | C31H34N4O5S3 |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 6-[(5Z)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3/C=C3\SC(=S)N(CCCCCC(=O)O)C3=O)c2)CC1 |
| InChI | InChI=1S/C31H34N4O5S3/c1-22-14-17-33(18-15-22)43(39,40)26-12-8-9-23(19-26)29-24(21-35(32-29)25-10-4-2-5-11-25)20-27-30(38)34(31(41)42-27)16-7-3-6-13-28(36)37/h2,4-5,8-12,19-22H,3,6-7,13-18H2,1H3,(H,36,37)/b27-20- |
| InChIKey | SFQVDPYKMKJJFE-OOAXWGSJSA-N |
| XLogP | 5.81 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|