C27H26N4O5S3 — CID 4700720
4-[4-oxo-5-[[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 4700720) has the molecular formula C27H26N4O5S3 and a molecular weight of 582.73 g/mol. Its IUPAC name is 4-[4-oxo-5-[[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[4-oxo-5-[[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 4700720 |
| Molecular Formula | C27H26N4O5S3 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 4-[4-oxo-5-[[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CCCC3)c2)SC1=S |
| InChI | InChI=1S/C27H26N4O5S3/c32-24(33)12-7-15-30-26(34)23(38-27(30)37)17-20-18-31(21-9-2-1-3-10-21)28-25(20)19-8-6-11-22(16-19)39(35,36)29-13-4-5-14-29/h1-3,6,8-11,16-18H,4-5,7,12-15H2,(H,32,33) |
| InChIKey | ZOEHPYJHMKEQAK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|