C33H32N4O3S3 — CID 4701132
5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4701132) has the molecular formula C33H32N4O3S3 and a molecular weight of 628.85 g/mol. Its IUPAC name is 5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4701132 |
| Molecular Formula | C33H32N4O3S3 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.16 |
| IUPAC Name | 5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CCCCCC3)c2)SC(=S)N1CCc1ccccc1 |
| InChI | InChI=1S/C33H32N4O3S3/c38-32-30(42-33(41)36(32)21-18-25-12-5-3-6-13-25)23-27-24-37(28-15-7-4-8-16-28)34-31(27)26-14-11-17-29(22-26)43(39,40)35-19-9-1-2-10-20-35/h3-8,11-17,22-24H,1-2,9-10,18-21H2 |
| InChIKey | ZETKMRSXBLXTBX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|