C28H28N4O4S3 — CID 6193126
(5Z)-3-(oxolan-2-ylmethyl)-5-[[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6193126) has the molecular formula C28H28N4O4S3 and a molecular weight of 580.76 g/mol. Its IUPAC name is (5Z)-3-(oxolan-2-ylmethyl)-5-[[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(oxolan-2-ylmethyl)-5-[[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6193126 |
| Molecular Formula | C28H28N4O4S3 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | (5Z)-3-(oxolan-2-ylmethyl)-5-[[1-phenyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CCCC3)c2)SC(=S)N1CC1CCCO1 |
| InChI | InChI=1S/C28H28N4O4S3/c33-27-25(38-28(37)31(27)19-23-11-7-15-36-23)17-21-18-32(22-9-2-1-3-10-22)29-26(21)20-8-6-12-24(16-20)39(34,35)30-13-4-5-14-30/h1-3,6,8-10,12,16-18,23H,4-5,7,11,13-15,19H2/b25-17- |
| InChIKey | DJMFGXDMLWTBMV-UQQQWYQISA-N |
| XLogP | 4.70 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|