C28H30N4O4S3 — CID 18806719
(5Z)-5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18806719) has the molecular formula C28H30N4O4S3 and a molecular weight of 582.77 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18806719 |
| Molecular Formula | C28H30N4O4S3 |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | (5Z)-5-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)/C(=C/c2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N3CCCCCC3)c2)SC1=S |
| InChI | InChI=1S/C28H30N4O4S3/c1-36-17-16-31-27(33)25(38-28(31)37)19-22-20-32(23-11-5-4-6-12-23)29-26(22)21-10-9-13-24(18-21)39(34,35)30-14-7-2-3-8-15-30/h4-6,9-13,18-20H,2-3,7-8,14-17H2,1H3/b25-19- |
| InChIKey | YVQYTAWQCXJVDC-PLRJNAJWSA-N |
| XLogP | 4.95 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|