C33H30N4O5S3 — CID 6193655
(5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6193655) has the molecular formula C33H30N4O5S3 and a molecular weight of 658.83 g/mol. Its IUPAC name is (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6193655 |
| Molecular Formula | C33H30N4O5S3 |
| Molecular Weight | 658.83 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | (5Z)-3-(1,3-benzodioxol-5-ylmethyl)-5-[[3-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3/C=C3\SC(=S)N(Cc4ccc5c(c4)OCO5)C3=O)c2)CC1 |
| InChI | InChI=1S/C33H30N4O5S3/c1-22-12-14-35(15-13-22)45(39,40)27-9-5-6-24(17-27)31-25(20-37(34-31)26-7-3-2-4-8-26)18-30-32(38)36(33(43)44-30)19-23-10-11-28-29(16-23)42-21-41-28/h2-11,16-18,20,22H,12-15,19,21H2,1H3/b30-18- |
| InChIKey | QYKIJQWWHBTKIN-YKQZZPSBSA-N |
| XLogP | 6.09 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.83 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|