C32H29FN4O3S3 — CID 6193688
(5Z)-3-[(4-fluorophenyl)methyl]-5-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6193688) has the molecular formula C32H29FN4O3S3 and a molecular weight of 632.81 g/mol. Its IUPAC name is (5Z)-3-[(4-fluorophenyl)methyl]-5-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(4-fluorophenyl)methyl]-5-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6193688 |
| Molecular Formula | C32H29FN4O3S3 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | (5Z)-3-[(4-fluorophenyl)methyl]-5-[[3-[3-(3-methylpiperidin-1-yl)sulfonylphenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1CCCN(S(=O)(=O)c2cccc(-c3nn(-c4ccccc4)cc3/C=C3\SC(=S)N(Cc4ccc(F)cc4)C3=O)c2)C1 |
| InChI | InChI=1S/C32H29FN4O3S3/c1-22-7-6-16-35(19-22)43(39,40)28-11-5-8-24(17-28)30-25(21-37(34-30)27-9-3-2-4-10-27)18-29-31(38)36(32(41)42-29)20-23-12-14-26(33)15-13-23/h2-5,8-15,17-18,21-22H,6-7,16,19-20H2,1H3/b29-18- |
| InChIKey | ORCJTSZGDHDTPI-MIXAMLLLSA-N |
| XLogP | 6.50 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|